C24H27NO4 — CID 108660258
1-cyclohexyl-4-hydroxy-2-(5-methylfuran-2-yl)-3-(3-phenylpropanoyl)-2H-pyrrol-5-one (PubChem CID 108660258) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 1-cyclohexyl-4-hydroxy-2-(5-methylfuran-2-yl)-3-(3-phenylpropanoyl)-2H-pyrrol-5-one.
| Compound Name | 1-cyclohexyl-4-hydroxy-2-(5-methylfuran-2-yl)-3-(3-phenylpropanoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108660258 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-cyclohexyl-4-hydroxy-2-(5-methylfuran-2-yl)-3-(3-phenylpropanoyl)-2H-pyrrol-5-one |
| SMILES | Cc1ccc(C2C(C(=O)CCc3ccccc3)=C(O)C(=O)N2C2CCCCC2)o1 |
| InChI | InChI=1S/C24H27NO4/c1-16-12-15-20(29-16)22-21(19(26)14-13-17-8-4-2-5-9-17)23(27)24(28)25(22)18-10-6-3-7-11-18/h2,4-5,8-9,12,15,18,22,27H,3,6-7,10-11,13-14H2,1H3 |
| InChIKey | RBDPWPJJOAJQQS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |