C29H30N2O4 — CID 108685584
2-(furan-2-yl)-4-hydroxy-1-[4-(4-methylpiperidin-1-yl)phenyl]-3-(3-phenylpropanoyl)-2H-pyrrol-5-one (PubChem CID 108685584) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-(furan-2-yl)-4-hydroxy-1-[4-(4-methylpiperidin-1-yl)phenyl]-3-(3-phenylpropanoyl)-2H-pyrrol-5-one.
| Compound Name | 2-(furan-2-yl)-4-hydroxy-1-[4-(4-methylpiperidin-1-yl)phenyl]-3-(3-phenylpropanoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108685584 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 2-(furan-2-yl)-4-hydroxy-1-[4-(4-methylpiperidin-1-yl)phenyl]-3-(3-phenylpropanoyl)-2H-pyrrol-5-one |
| SMILES | CC1CCN(c2ccc(N3C(=O)C(O)=C(C(=O)CCc4ccccc4)C3c3ccco3)cc2)CC1 |
| InChI | InChI=1S/C29H30N2O4/c1-20-15-17-30(18-16-20)22-10-12-23(13-11-22)31-27(25-8-5-19-35-25)26(28(33)29(31)34)24(32)14-9-21-6-3-2-4-7-21/h2-8,10-13,19-20,27,33H,9,14-18H2,1H3 |
| InChIKey | MJSRTEICJIJSPL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|