C22H13F2N3O5 — CID 108634095
(4E)-1-(2,5-difluorophenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-pyridin-4-ylpyrrolidine-2,3-dione (PubChem CID 108634095) has the molecular formula C22H13F2N3O5 and a molecular weight of 437.36 g/mol. Its IUPAC name is (4E)-1-(2,5-difluorophenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-pyridin-4-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(2,5-difluorophenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-pyridin-4-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108634095 |
| Molecular Formula | C22H13F2N3O5 |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | (4E)-1-(2,5-difluorophenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-pyridin-4-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2cc(F)ccc2F)C(c2ccncc2)/C1=C(\O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H13F2N3O5/c23-14-3-6-16(24)17(11-14)26-19(12-7-9-25-10-8-12)18(21(29)22(26)30)20(28)13-1-4-15(5-2-13)27(31)32/h1-11,19,28H/b20-18+ |
| InChIKey | CGLNJTYHSYMGKI-CZIZESTLSA-N |
| XLogP | 3.89 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|