C25H26ClNO4 — CID 108641686
(4Z)-5-(4-chlorophenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-pentylpyrrolidine-2,3-dione (PubChem CID 108641686) has the molecular formula C25H26ClNO4 and a molecular weight of 439.94 g/mol. Its IUPAC name is (4Z)-5-(4-chlorophenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-pentylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(4-chlorophenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-pentylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108641686 |
| Molecular Formula | C25H26ClNO4 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (4Z)-5-(4-chlorophenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-pentylpyrrolidine-2,3-dione |
| SMILES | CCCCCN1C(=O)C(=O)/C(=C(\O)c2ccc3c(c2)CC(C)O3)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H26ClNO4/c1-3-4-5-12-27-22(16-6-9-19(26)10-7-16)21(24(29)25(27)30)23(28)17-8-11-20-18(14-17)13-15(2)31-20/h6-11,14-15,22,28H,3-5,12-13H2,1-2H3/b23-21- |
| InChIKey | PDXJPXSGHLGDTA-LNVKXUELSA-N |
| XLogP | 5.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|