C28H26FNO4 — CID 108642524
(4Z)-5-(4-fluorophenyl)-4-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-1-(4-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108642524) has the molecular formula C28H26FNO4 and a molecular weight of 459.52 g/mol. Its IUPAC name is (4Z)-5-(4-fluorophenyl)-4-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-1-(4-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(4-fluorophenyl)-4-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-1-(4-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108642524 |
| Molecular Formula | C28H26FNO4 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (4Z)-5-(4-fluorophenyl)-4-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-1-(4-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1ccc(/C(O)=C2/C(=O)C(=O)N(c3ccc(C)cc3)C2c2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C28H26FNO4/c1-4-15-34-23-14-9-20(16-18(23)3)26(31)24-25(19-7-10-21(29)11-8-19)30(28(33)27(24)32)22-12-5-17(2)6-13-22/h5-14,16,25,31H,4,15H2,1-3H3/b26-24- |
| InChIKey | NBNISONIZGBFTM-LCUIJRPUSA-N |
| XLogP | 5.86 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|