C31H30N2O5 — CID 108675344
4-[(4Z)-4-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-2,3-dioxo-5-(4-propoxyphenyl)pyrrolidin-1-yl]benzonitrile (PubChem CID 108675344) has the molecular formula C31H30N2O5 and a molecular weight of 510.59 g/mol. Its IUPAC name is 4-[(4Z)-4-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-2,3-dioxo-5-(4-propoxyphenyl)pyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(4Z)-4-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-2,3-dioxo-5-(4-propoxyphenyl)pyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108675344 |
| Molecular Formula | C31H30N2O5 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 4-[(4Z)-4-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-2,3-dioxo-5-(4-propoxyphenyl)pyrrolidin-1-yl]benzonitrile |
| SMILES | CCCOc1ccc(C2/C(=C(/O)c3ccc(OCCC)c(C)c3)C(=O)C(=O)N2c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C31H30N2O5/c1-4-16-37-25-13-8-22(9-14-25)28-27(29(34)23-10-15-26(20(3)18-23)38-17-5-2)30(35)31(36)33(28)24-11-6-21(19-32)7-12-24/h6-15,18,28,34H,4-5,16-17H2,1-3H3/b29-27- |
| InChIKey | MBOZSEIEOSXZTJ-OHYPFYFLSA-N |
| XLogP | 6.07 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|