C23H23Cl2NO4 — CID 108644202
(4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy-(3-propan-2-yloxyphenyl)methylidene]-1-propylpyrrolidine-2,3-dione (PubChem CID 108644202) has the molecular formula C23H23Cl2NO4 and a molecular weight of 448.35 g/mol. Its IUPAC name is (4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy-(3-propan-2-yloxyphenyl)methylidene]-1-propylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy-(3-propan-2-yloxyphenyl)methylidene]-1-propylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108644202 |
| Molecular Formula | C23H23Cl2NO4 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | (4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy-(3-propan-2-yloxyphenyl)methylidene]-1-propylpyrrolidine-2,3-dione |
| SMILES | CCCN1C(=O)C(=O)/C(=C(\O)c2cccc(OC(C)C)c2)C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H23Cl2NO4/c1-4-10-26-20(14-8-9-17(24)18(25)12-14)19(22(28)23(26)29)21(27)15-6-5-7-16(11-15)30-13(2)3/h5-9,11-13,20,27H,4,10H2,1-3H3/b21-19- |
| InChIKey | JIJFFSTXRMYNRJ-VZCXRCSSSA-N |
| XLogP | 5.61 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|