C22H21Cl2NO4 — CID 108644200
(4Z)-5-(3,4-dichlorophenyl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-1-propylpyrrolidine-2,3-dione (PubChem CID 108644200) has the molecular formula C22H21Cl2NO4 and a molecular weight of 434.32 g/mol. Its IUPAC name is (4Z)-5-(3,4-dichlorophenyl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-1-propylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(3,4-dichlorophenyl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-1-propylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108644200 |
| Molecular Formula | C22H21Cl2NO4 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | (4Z)-5-(3,4-dichlorophenyl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-1-propylpyrrolidine-2,3-dione |
| SMILES | CCCN1C(=O)C(=O)/C(=C(\O)c2cccc(OCC)c2)C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H21Cl2NO4/c1-3-10-25-19(13-8-9-16(23)17(24)12-13)18(21(27)22(25)28)20(26)14-6-5-7-15(11-14)29-4-2/h5-9,11-12,19,26H,3-4,10H2,1-2H3/b20-18- |
| InChIKey | GHLHVVOCGPAJJL-ZZEZOPTASA-N |
| XLogP | 5.22 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|