C26H21Cl2NO4 — CID 3397829
1-benzyl-5-(3,4-dichlorophenyl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione (PubChem CID 3397829) has the molecular formula C26H21Cl2NO4 and a molecular weight of 482.36 g/mol. Its IUPAC name is 1-benzyl-5-(3,4-dichlorophenyl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione.
| Compound Name | 1-benzyl-5-(3,4-dichlorophenyl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3397829 |
| Molecular Formula | C26H21Cl2NO4 |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 1-benzyl-5-(3,4-dichlorophenyl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1cccc(C(O)=C2C(=O)C(=O)N(Cc3ccccc3)C2c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C26H21Cl2NO4/c1-2-33-19-10-6-9-18(13-19)24(30)22-23(17-11-12-20(27)21(28)14-17)29(26(32)25(22)31)15-16-7-4-3-5-8-16/h3-14,23,30H,2,15H2,1H3 |
| InChIKey | VBIMURCUFWMDOC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|