C26H20Cl3NO5 — CID 44867535
(4E)-4-[[3-[(2-chlorophenyl)methoxy]phenyl]-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-(2-hydroxyethyl)pyrrolidine-2,3-dione (PubChem CID 44867535) has the molecular formula C26H20Cl3NO5 and a molecular weight of 532.81 g/mol. Its IUPAC name is (4E)-4-[[3-[(2-chlorophenyl)methoxy]phenyl]-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-(2-hydroxyethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[[3-[(2-chlorophenyl)methoxy]phenyl]-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-(2-hydroxyethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 44867535 |
| Molecular Formula | C26H20Cl3NO5 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | (4E)-4-[[3-[(2-chlorophenyl)methoxy]phenyl]-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-(2-hydroxyethyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCO)C(c2ccc(Cl)c(Cl)c2)/C1=C(\O)c1cccc(OCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C26H20Cl3NO5/c27-19-7-2-1-4-17(19)14-35-18-6-3-5-16(12-18)24(32)22-23(15-8-9-20(28)21(29)13-15)30(10-11-31)26(34)25(22)33/h1-9,12-13,23,31-32H,10-11,14H2/b24-22+ |
| InChIKey | ODHHARMGQBUERT-ZNTNEXAZSA-N |
| XLogP | 5.64 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|