C21H17Cl4NO4 — CID 108644206
(4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-propylpyrrolidine-2,3-dione (PubChem CID 108644206) has the molecular formula C21H17Cl4NO4 and a molecular weight of 489.18 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-propylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-propylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108644206 |
| Molecular Formula | C21H17Cl4NO4 |
| Molecular Weight | 489.18 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-propylpyrrolidine-2,3-dione |
| SMILES | CCCN1C(=O)C(=O)/C(=C(/O)c2cc(Cl)cc(Cl)c2OC)C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H17Cl4NO4/c1-3-6-26-17(10-4-5-13(23)14(24)7-10)16(19(28)21(26)29)18(27)12-8-11(22)9-15(25)20(12)30-2/h4-5,7-9,17,27H,3,6H2,1-2H3/b18-16+ |
| InChIKey | YJQNVGHTSRWGNX-FBMGVBCBSA-N |
| XLogP | 6.14 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.18 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|