C21H18Cl2FNO4 — CID 108643387
(4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)-1-propylpyrrolidine-2,3-dione (PubChem CID 108643387) has the molecular formula C21H18Cl2FNO4 and a molecular weight of 438.28 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)-1-propylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)-1-propylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108643387 |
| Molecular Formula | C21H18Cl2FNO4 |
| Molecular Weight | 438.28 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)-1-propylpyrrolidine-2,3-dione |
| SMILES | CCCN1C(=O)C(=O)/C(=C(/O)c2cc(Cl)cc(Cl)c2OC)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H18Cl2FNO4/c1-3-8-25-17(11-4-6-13(24)7-5-11)16(19(27)21(25)28)18(26)14-9-12(22)10-15(23)20(14)29-2/h4-7,9-10,17,26H,3,8H2,1-2H3/b18-16+ |
| InChIKey | TXFXQRKYRHHFHE-FBMGVBCBSA-N |
| XLogP | 4.97 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.28 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|