C30H32N6O6 — CID 10864745
(E)-N-[(2R,3R,4S,5R)-2-[6-(2,3-dihydro-1H-inden-2-ylamino)purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-3-(3,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 10864745) has the molecular formula C30H32N6O6 and a molecular weight of 572.62 g/mol. Its IUPAC name is (E)-N-[(2R,3R,4S,5R)-2-[6-(2,3-dihydro-1H-inden-2-ylamino)purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-3-(3,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(2R,3R,4S,5R)-2-[6-(2,3-dihydro-1H-inden-2-ylamino)purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-3-(3,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 10864745 |
| Molecular Formula | C30H32N6O6 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | (E)-N-[(2R,3R,4S,5R)-2-[6-(2,3-dihydro-1H-inden-2-ylamino)purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-3-(3,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N[C@@H]2[C@H](O)[C@@H](CO)O[C@H]2n2cnc3c(NC4Cc5ccccc5C4)ncnc32)cc(OC)c1 |
| InChI | InChI=1S/C30H32N6O6/c1-40-21-9-17(10-22(13-21)41-2)7-8-24(38)35-25-27(39)23(14-37)42-30(25)36-16-33-26-28(31-15-32-29(26)36)34-20-11-18-5-3-4-6-19(18)12-20/h3-10,13,15-16,20,23,25,27,30,37,39H,11-12,14H2,1-2H3,(H,35,38)(H,31,32,34)/b8-7+/t23-,25-,27-,30-/m1/s1 |
| InChIKey | ISCPNCCDEYKGQM-IAINDICFSA-N |
| XLogP | 1.87 |
| TPSA | 152.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|