C26H27ClN6O6 — CID 10951814
4-chloro-N-[(2R,3R,4S,5R)-2-[6-(2,3-dihydro-1H-inden-2-ylamino)purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-5,6-dihydroxycyclohexa-1,3-diene-1-carboxamide (PubChem CID 10951814) has the molecular formula C26H27ClN6O6 and a molecular weight of 554.99 g/mol. Its IUPAC name is 4-chloro-N-[(2R,3R,4S,5R)-2-[6-(2,3-dihydro-1H-inden-2-ylamino)purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-5,6-dihydroxycyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 4-chloro-N-[(2R,3R,4S,5R)-2-[6-(2,3-dihydro-1H-inden-2-ylamino)purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-5,6-dihydroxycyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 10951814 |
| Molecular Formula | C26H27ClN6O6 |
| Molecular Weight | 554.99 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 4-chloro-N-[(2R,3R,4S,5R)-2-[6-(2,3-dihydro-1H-inden-2-ylamino)purin-9-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-5,6-dihydroxycyclohexa-1,3-diene-1-carboxamide |
| SMILES | O=C(N[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(NC3Cc4ccccc4C3)ncnc21)C1=CC=C(Cl)C(O)C1O |
| InChI | InChI=1S/C26H27ClN6O6/c27-16-6-5-15(20(35)21(16)36)25(38)32-18-22(37)17(9-34)39-26(18)33-11-30-19-23(28-10-29-24(19)33)31-14-7-12-3-1-2-4-13(12)8-14/h1-6,10-11,14,17-18,20-22,26,34-37H,7-9H2,(H,32,38)(H,28,29,31)/t17-,18-,20?,21?,22-,26-/m1/s1 |
| InChIKey | YWBBWBMFDNAXHJ-IKKLAHGWSA-N |
| XLogP | -0.07 |
| TPSA | 174.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.99 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |