C25H28ClNO7 — CID 108648759
(4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione (PubChem CID 108648759) has the molecular formula C25H28ClNO7 and a molecular weight of 489.95 g/mol. Its IUPAC name is (4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108648759 |
| Molecular Formula | C25H28ClNO7 |
| Molecular Weight | 489.95 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(OC)c(/C(O)=C2\C(=O)C(=O)N(CCCOC(C)C)C2c2cccc(O)c2)cc1Cl |
| InChI | InChI=1S/C25H28ClNO7/c1-14(2)34-10-6-9-27-22(15-7-5-8-16(28)11-15)21(24(30)25(27)31)23(29)17-12-18(26)20(33-4)13-19(17)32-3/h5,7-8,11-14,22,28-29H,6,9-10H2,1-4H3/b23-21+ |
| InChIKey | XIAPMSBWDATWBI-XTQSDGFTSA-N |
| XLogP | 4.30 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.95 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|