C24H28ClNO6S — CID 108610873
(4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3-methylthiophen-2-yl)-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione (PubChem CID 108610873) has the molecular formula C24H28ClNO6S and a molecular weight of 494.01 g/mol. Its IUPAC name is (4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3-methylthiophen-2-yl)-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3-methylthiophen-2-yl)-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108610873 |
| Molecular Formula | C24H28ClNO6S |
| Molecular Weight | 494.01 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | (4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3-methylthiophen-2-yl)-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(OC)c(/C(O)=C2\C(=O)C(=O)N(CCCOC(C)C)C2c2sccc2C)cc1Cl |
| InChI | InChI=1S/C24H28ClNO6S/c1-13(2)32-9-6-8-26-20(23-14(3)7-10-33-23)19(22(28)24(26)29)21(27)15-11-16(25)18(31-5)12-17(15)30-4/h7,10-13,20,27H,6,8-9H2,1-5H3/b21-19+ |
| InChIKey | LARBOPMNKCAYLP-XUTLUUPISA-N |
| XLogP | 4.96 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.01 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|