C22H25ClN2O5S — CID 108662917
(4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione (PubChem CID 108662917) has the molecular formula C22H25ClN2O5S and a molecular weight of 464.97 g/mol. Its IUPAC name is (4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108662917 |
| Molecular Formula | C22H25ClN2O5S |
| Molecular Weight | 464.97 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | (4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(/C(O)=C2\C(=O)C(=O)N(CCN(C)C)C2c2sccc2C)c(OC)cc1Cl |
| InChI | InChI=1S/C22H25ClN2O5S/c1-12-6-9-31-21(12)18-17(20(27)22(28)25(18)8-7-24(2)3)19(26)13-10-16(30-5)14(23)11-15(13)29-4/h6,9-11,18,26H,7-8H2,1-5H3/b19-17+ |
| InChIKey | BKIFKGLMMXGGCK-HTXNQAPBSA-N |
| XLogP | 3.71 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.97 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|