C42H60Si — CID 10864890
(3,3-dimethyl-2-phenylbut-1-enylidene)-bis[2,4,6-tri(propan-2-yl)phenyl]silane (PubChem CID 10864890) has the molecular formula C42H60Si and a molecular weight of 593.03 g/mol. Its IUPAC name is (3,3-dimethyl-2-phenylbut-1-enylidene)-bis[2,4,6-tri(propan-2-yl)phenyl]silane.
| Compound Name | (3,3-dimethyl-2-phenylbut-1-enylidene)-bis[2,4,6-tri(propan-2-yl)phenyl]silane |
|---|---|
| PubChem CID | 10864890 |
| Molecular Formula | C42H60Si |
| Molecular Weight | 593.03 g/mol |
| Exact Mass | 592.45 |
| IUPAC Name | (3,3-dimethyl-2-phenylbut-1-enylidene)-bis[2,4,6-tri(propan-2-yl)phenyl]silane |
| SMILES | CC(C)c1cc(C(C)C)c([Si](=C=C(c2ccccc2)C(C)(C)C)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C42H60Si/c1-26(2)33-21-35(28(5)6)40(36(22-33)29(7)8)43(25-39(42(13,14)15)32-19-17-16-18-20-32)41-37(30(9)10)23-34(27(3)4)24-38(41)31(11)12/h16-24,26-31H,1-15H3 |
| InChIKey | DPUQNVZLXLYAEY-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.03 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|