C22H13Cl2F2NO5 — CID 108655739
(4Z)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-1-(2,5-difluorophenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione (PubChem CID 108655739) has the molecular formula C22H13Cl2F2NO5 and a molecular weight of 480.25 g/mol. Its IUPAC name is (4Z)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-1-(2,5-difluorophenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-1-(2,5-difluorophenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108655739 |
| Molecular Formula | C22H13Cl2F2NO5 |
| Molecular Weight | 480.25 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | (4Z)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-1-(2,5-difluorophenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(Cl)cc1/C(O)=C1/C(=O)C(=O)N(c2cc(F)ccc2F)C1c1ccco1 |
| InChI | InChI=1S/C22H13Cl2F2NO5/c1-31-21-12(7-10(23)8-13(21)24)19(28)17-18(16-3-2-6-32-16)27(22(30)20(17)29)15-9-11(25)4-5-14(15)26/h2-9,18,28H,1H3/b19-17- |
| InChIKey | IVTYXBSDZNKURI-ZPHPHTNESA-N |
| XLogP | 5.50 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.25 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|