C23H16ClF2NO6 — CID 108655741
(4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-1-(2,5-difluorophenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione (PubChem CID 108655741) has the molecular formula C23H16ClF2NO6 and a molecular weight of 475.83 g/mol. Its IUPAC name is (4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-1-(2,5-difluorophenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-1-(2,5-difluorophenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108655741 |
| Molecular Formula | C23H16ClF2NO6 |
| Molecular Weight | 475.83 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | (4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-1-(2,5-difluorophenyl)-5-(furan-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(/C(O)=C2\C(=O)C(=O)N(c3cc(F)ccc3F)C2c2ccco2)c(OC)cc1Cl |
| InChI | InChI=1S/C23H16ClF2NO6/c1-31-17-10-13(24)18(32-2)9-12(17)21(28)19-20(16-4-3-7-33-16)27(23(30)22(19)29)15-8-11(25)5-6-14(15)26/h3-10,20,28H,1-2H3/b21-19+ |
| InChIKey | NACVAQGGCMPWHJ-XUTLUUPISA-N |
| XLogP | 4.85 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.83 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|