C18H23NO5 — CID 108655949
2-(furan-2-yl)-4-hydroxy-3-(3-methylbutanoyl)-1-(oxolan-2-ylmethyl)-2H-pyrrol-5-one (PubChem CID 108655949) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-(furan-2-yl)-4-hydroxy-3-(3-methylbutanoyl)-1-(oxolan-2-ylmethyl)-2H-pyrrol-5-one.
| Compound Name | 2-(furan-2-yl)-4-hydroxy-3-(3-methylbutanoyl)-1-(oxolan-2-ylmethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108655949 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-(furan-2-yl)-4-hydroxy-3-(3-methylbutanoyl)-1-(oxolan-2-ylmethyl)-2H-pyrrol-5-one |
| SMILES | CC(C)CC(=O)C1=C(O)C(=O)N(CC2CCCO2)C1c1ccco1 |
| InChI | InChI=1S/C18H23NO5/c1-11(2)9-13(20)15-16(14-6-4-8-24-14)19(18(22)17(15)21)10-12-5-3-7-23-12/h4,6,8,11-12,16,21H,3,5,7,9-10H2,1-2H3 |
| InChIKey | NMDJGXBQQXCHFY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |