C21H17NO6 — CID 108657236
3-(furan-2-carbonyl)-2-(furan-2-yl)-4-hydroxy-1-[(3-methoxyphenyl)methyl]-2H-pyrrol-5-one (PubChem CID 108657236) has the molecular formula C21H17NO6 and a molecular weight of 379.37 g/mol. Its IUPAC name is 3-(furan-2-carbonyl)-2-(furan-2-yl)-4-hydroxy-1-[(3-methoxyphenyl)methyl]-2H-pyrrol-5-one.
| Compound Name | 3-(furan-2-carbonyl)-2-(furan-2-yl)-4-hydroxy-1-[(3-methoxyphenyl)methyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108657236 |
| Molecular Formula | C21H17NO6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3-(furan-2-carbonyl)-2-(furan-2-yl)-4-hydroxy-1-[(3-methoxyphenyl)methyl]-2H-pyrrol-5-one |
| SMILES | COc1cccc(CN2C(=O)C(O)=C(C(=O)c3ccco3)C2c2ccco2)c1 |
| InChI | InChI=1S/C21H17NO6/c1-26-14-6-2-5-13(11-14)12-22-18(15-7-3-9-27-15)17(20(24)21(22)25)19(23)16-8-4-10-28-16/h2-11,18,24H,12H2,1H3 |
| InChIKey | ZZURFKCMBYGANT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |