C18H13NO5S — CID 108652917
3-(furan-2-carbonyl)-2-(furan-2-yl)-4-hydroxy-1-(thiophen-2-ylmethyl)-2H-pyrrol-5-one (PubChem CID 108652917) has the molecular formula C18H13NO5S and a molecular weight of 355.37 g/mol. Its IUPAC name is 3-(furan-2-carbonyl)-2-(furan-2-yl)-4-hydroxy-1-(thiophen-2-ylmethyl)-2H-pyrrol-5-one.
| Compound Name | 3-(furan-2-carbonyl)-2-(furan-2-yl)-4-hydroxy-1-(thiophen-2-ylmethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108652917 |
| Molecular Formula | C18H13NO5S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 3-(furan-2-carbonyl)-2-(furan-2-yl)-4-hydroxy-1-(thiophen-2-ylmethyl)-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(Cc2cccs2)C1c1ccco1)c1ccco1 |
| InChI | InChI=1S/C18H13NO5S/c20-16(13-6-2-8-24-13)14-15(12-5-1-7-23-12)19(18(22)17(14)21)10-11-4-3-9-25-11/h1-9,15,21H,10H2 |
| InChIKey | ISXLSUUVMZMHSC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |