C27H25N3O5 — CID 108657487
(4E)-1-(1H-benzimidazol-2-yl)-5-(furan-2-yl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108657487) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is (4E)-1-(1H-benzimidazol-2-yl)-5-(furan-2-yl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(1H-benzimidazol-2-yl)-5-(furan-2-yl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108657487 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | (4E)-1-(1H-benzimidazol-2-yl)-5-(furan-2-yl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccccc4[nH]3)C2c2ccco2)cc1 |
| InChI | InChI=1S/C27H25N3O5/c1-2-3-6-15-34-18-13-11-17(12-14-18)24(31)22-23(21-10-7-16-35-21)30(26(33)25(22)32)27-28-19-8-4-5-9-20(19)29-27/h4-5,7-14,16,23,31H,2-3,6,15H2,1H3,(H,28,29)/b24-22+ |
| InChIKey | CMANFYCQTQPQRZ-ZNTNEXAZSA-N |
| XLogP | 5.35 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|