C29H28N4O4 — CID 108590676
(4E)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-1-(6-methyl-1H-benzimidazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione (PubChem CID 108590676) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-1-(6-methyl-1H-benzimidazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-1-(6-methyl-1H-benzimidazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108590676 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | (4E)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-1-(6-methyl-1H-benzimidazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(C)cc4[nH]3)C2c2ccccn2)cc1 |
| InChI | InChI=1S/C29H28N4O4/c1-3-4-7-16-37-20-12-10-19(11-13-20)26(34)24-25(22-8-5-6-15-30-22)33(28(36)27(24)35)29-31-21-14-9-18(2)17-23(21)32-29/h5-6,8-15,17,25,34H,3-4,7,16H2,1-2H3,(H,31,32)/b26-24+ |
| InChIKey | KLBRLPDRSZOUJH-SHHOIMCASA-N |
| XLogP | 5.46 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|