C33H35N3O5 — CID 108721075
(4E)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-1-(6-methyl-1H-benzimidazol-2-yl)-5-(4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108721075) has the molecular formula C33H35N3O5 and a molecular weight of 553.66 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-1-(6-methyl-1H-benzimidazol-2-yl)-5-(4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-1-(6-methyl-1H-benzimidazol-2-yl)-5-(4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108721075 |
| Molecular Formula | C33H35N3O5 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | (4E)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-1-(6-methyl-1H-benzimidazol-2-yl)-5-(4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(C)cc4[nH]3)C2c2ccc(OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H35N3O5/c1-5-6-7-18-40-24-13-11-23(12-14-24)30(37)28-29(22-9-15-25(16-10-22)41-20(2)3)36(32(39)31(28)38)33-34-26-17-8-21(4)19-27(26)35-33/h8-17,19-20,29,37H,5-7,18H2,1-4H3,(H,34,35)/b30-28+ |
| InChIKey | KXBURGFHOBFRSL-SJCQXOIGSA-N |
| XLogP | 6.85 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|