C23H26ClNO7 — CID 108657799
(4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-(2-propan-2-yloxyethyl)pyrrolidine-2,3-dione (PubChem CID 108657799) has the molecular formula C23H26ClNO7 and a molecular weight of 463.91 g/mol. Its IUPAC name is (4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-(2-propan-2-yloxyethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-(2-propan-2-yloxyethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108657799 |
| Molecular Formula | C23H26ClNO7 |
| Molecular Weight | 463.91 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | (4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-(2-propan-2-yloxyethyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(/C(O)=C2\C(=O)C(=O)N(CCOC(C)C)C2c2ccc(C)o2)c(OC)cc1Cl |
| InChI | InChI=1S/C23H26ClNO7/c1-12(2)31-9-8-25-20(16-7-6-13(3)32-16)19(22(27)23(25)28)21(26)14-10-18(30-5)15(24)11-17(14)29-4/h6-7,10-12,20,26H,8-9H2,1-5H3/b21-19+ |
| InChIKey | NJWAYRYJVAIXKI-XUTLUUPISA-N |
| XLogP | 4.11 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.91 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|