C24H23NO4S2 — CID 108661352
(4Z)-4-[hydroxy-(3-propoxyphenyl)methylidene]-5-(3-methylthiophen-2-yl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 108661352) has the molecular formula C24H23NO4S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is (4Z)-4-[hydroxy-(3-propoxyphenyl)methylidene]-5-(3-methylthiophen-2-yl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[hydroxy-(3-propoxyphenyl)methylidene]-5-(3-methylthiophen-2-yl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108661352 |
| Molecular Formula | C24H23NO4S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | (4Z)-4-[hydroxy-(3-propoxyphenyl)methylidene]-5-(3-methylthiophen-2-yl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1cccc(/C(O)=C2/C(=O)C(=O)N(Cc3cccs3)C2c2sccc2C)c1 |
| InChI | InChI=1S/C24H23NO4S2/c1-3-10-29-17-7-4-6-16(13-17)21(26)19-20(23-15(2)9-12-31-23)25(24(28)22(19)27)14-18-8-5-11-30-18/h4-9,11-13,20,26H,3,10,14H2,1-2H3/b21-19- |
| InChIKey | PYGJDRMDWAVYFR-VZCXRCSSSA-N |
| XLogP | 5.53 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|