C22H19NO3S2 — CID 108661381
(4Z)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(3-methylthiophen-2-yl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 108661381) has the molecular formula C22H19NO3S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is (4Z)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(3-methylthiophen-2-yl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(3-methylthiophen-2-yl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108661381 |
| Molecular Formula | C22H19NO3S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | (4Z)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(3-methylthiophen-2-yl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(/C(O)=C2/C(=O)C(=O)N(Cc3cccs3)C2c2sccc2C)cc1 |
| InChI | InChI=1S/C22H19NO3S2/c1-13-5-7-15(8-6-13)19(24)17-18(21-14(2)9-11-28-21)23(22(26)20(17)25)12-16-4-3-10-27-16/h3-11,18,24H,12H2,1-2H3/b19-17- |
| InChIKey | ALWRLKSRJWUUHT-ZPHPHTNESA-N |
| XLogP | 5.05 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|