C23H27NO6S — CID 108661454
(4E)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione (PubChem CID 108661454) has the molecular formula C23H27NO6S and a molecular weight of 445.54 g/mol. Its IUPAC name is (4E)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108661454 |
| Molecular Formula | C23H27NO6S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | (4E)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(CCOC)C2c2sccc2C)c(OCC)c1 |
| InChI | InChI=1S/C23H27NO6S/c1-5-29-15-7-8-16(17(13-15)30-6-2)20(25)18-19(22-14(3)9-12-31-22)24(10-11-28-4)23(27)21(18)26/h7-9,12-13,19,25H,5-6,10-11H2,1-4H3/b20-18+ |
| InChIKey | NBCWZNKYUZWVSZ-CZIZESTLSA-N |
| XLogP | 3.92 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|