C20H20BrNO3S — CID 108663075
(4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-5-(3-methylthiophen-2-yl)-1-propylpyrrolidine-2,3-dione (PubChem CID 108663075) has the molecular formula C20H20BrNO3S and a molecular weight of 434.36 g/mol. Its IUPAC name is (4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-5-(3-methylthiophen-2-yl)-1-propylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-5-(3-methylthiophen-2-yl)-1-propylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108663075 |
| Molecular Formula | C20H20BrNO3S |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | (4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-5-(3-methylthiophen-2-yl)-1-propylpyrrolidine-2,3-dione |
| SMILES | CCCN1C(=O)C(=O)/C(=C(\O)c2ccc(Br)c(C)c2)C1c1sccc1C |
| InChI | InChI=1S/C20H20BrNO3S/c1-4-8-22-16(19-11(2)7-9-26-19)15(18(24)20(22)25)17(23)13-5-6-14(21)12(3)10-13/h5-7,9-10,16,23H,4,8H2,1-3H3/b17-15- |
| InChIKey | FXWRVYUNVJFLCV-ICFOKQHNSA-N |
| XLogP | 4.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|