C20H25NO5 — CID 108663558
[4-[3-(2,2-dimethylpropanoyl)-4-hydroxy-5-oxo-1-propyl-2H-pyrrol-2-yl]phenyl] acetate (PubChem CID 108663558) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is [4-[3-(2,2-dimethylpropanoyl)-4-hydroxy-5-oxo-1-propyl-2H-pyrrol-2-yl]phenyl] acetate.
| Compound Name | [4-[3-(2,2-dimethylpropanoyl)-4-hydroxy-5-oxo-1-propyl-2H-pyrrol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108663558 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | [4-[3-(2,2-dimethylpropanoyl)-4-hydroxy-5-oxo-1-propyl-2H-pyrrol-2-yl]phenyl] acetate |
| SMILES | CCCN1C(=O)C(O)=C(C(=O)C(C)(C)C)C1c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C20H25NO5/c1-6-11-21-16(13-7-9-14(10-8-13)26-12(2)22)15(17(23)19(21)25)18(24)20(3,4)5/h7-10,16,23H,6,11H2,1-5H3 |
| InChIKey | TXEKPQWNUOTHCB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|