C19H23NO5 — CID 108663473
[4-(1-butyl-4-hydroxy-5-oxo-3-propanoyl-2H-pyrrol-2-yl)phenyl] acetate (PubChem CID 108663473) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is [4-(1-butyl-4-hydroxy-5-oxo-3-propanoyl-2H-pyrrol-2-yl)phenyl] acetate.
| Compound Name | [4-(1-butyl-4-hydroxy-5-oxo-3-propanoyl-2H-pyrrol-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 108663473 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [4-(1-butyl-4-hydroxy-5-oxo-3-propanoyl-2H-pyrrol-2-yl)phenyl] acetate |
| SMILES | CCCCN1C(=O)C(O)=C(C(=O)CC)C1c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C19H23NO5/c1-4-6-11-20-17(16(15(22)5-2)18(23)19(20)24)13-7-9-14(10-8-13)25-12(3)21/h7-10,17,23H,4-6,11H2,1-3H3 |
| InChIKey | YTMJMNLCYDOOOM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|