C25H27NO6 — CID 108663584
[4-[(3E)-3-[hydroxy-(4-methoxy-2,5-dimethylphenyl)methylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate (PubChem CID 108663584) has the molecular formula C25H27NO6 and a molecular weight of 437.49 g/mol. Its IUPAC name is [4-[(3E)-3-[hydroxy-(4-methoxy-2,5-dimethylphenyl)methylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [4-[(3E)-3-[hydroxy-(4-methoxy-2,5-dimethylphenyl)methylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108663584 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | [4-[(3E)-3-[hydroxy-(4-methoxy-2,5-dimethylphenyl)methylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate |
| SMILES | CCCN1C(=O)C(=O)/C(=C(/O)c2cc(C)c(OC)cc2C)C1c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C25H27NO6/c1-6-11-26-22(17-7-9-18(10-8-17)32-16(4)27)21(24(29)25(26)30)23(28)19-12-15(3)20(31-5)13-14(19)2/h7-10,12-13,22,28H,6,11H2,1-5H3/b23-21+ |
| InChIKey | MTCVFCXQOFHMOU-XTQSDGFTSA-N |
| XLogP | 4.07 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|