C24H23Cl2NO7 — CID 108663582
[4-[(3E)-3-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate (PubChem CID 108663582) has the molecular formula C24H23Cl2NO7 and a molecular weight of 508.35 g/mol. Its IUPAC name is [4-[(3E)-3-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [4-[(3E)-3-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108663582 |
| Molecular Formula | C24H23Cl2NO7 |
| Molecular Weight | 508.35 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | [4-[(3E)-3-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-4,5-dioxo-1-propylpyrrolidin-2-yl]phenyl] acetate |
| SMILES | CCCN1C(=O)C(=O)/C(=C(/O)c2cc(Cl)c(OC)c(Cl)c2OC)C1c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C24H23Cl2NO7/c1-5-10-27-19(13-6-8-14(9-7-13)34-12(2)28)17(21(30)24(27)31)20(29)15-11-16(25)23(33-4)18(26)22(15)32-3/h6-9,11,19,29H,5,10H2,1-4H3/b20-17+ |
| InChIKey | QKWCLFSPWGHHDC-LVZFUZTISA-N |
| XLogP | 4.77 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|