C29H27Cl2NO8 — CID 108697424
(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(4-methoxyphenoxy)ethyl]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108697424) has the molecular formula C29H27Cl2NO8 and a molecular weight of 588.44 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(4-methoxyphenoxy)ethyl]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(4-methoxyphenoxy)ethyl]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108697424 |
| Molecular Formula | C29H27Cl2NO8 |
| Molecular Weight | 588.44 g/mol |
| Exact Mass | 587.11 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(4-methoxyphenoxy)ethyl]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(OCCN2C(=O)C(=O)/C(=C(/O)c3cc(Cl)c(OC)c(Cl)c3OC)C2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H27Cl2NO8/c1-36-17-7-5-16(6-8-17)24-22(25(33)20-15-21(30)28(39-4)23(31)27(20)38-3)26(34)29(35)32(24)13-14-40-19-11-9-18(37-2)10-12-19/h5-12,15,24,33H,13-14H2,1-4H3/b25-22+ |
| InChIKey | ZQKUSJJRXSRTOC-YYDJUVGSSA-N |
| XLogP | 5.53 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|