C6H15N3 — CID 10866359
1-pyrrolidin-2-ylethane-1,2-diamine (PubChem CID 10866359) has the molecular formula C6H15N3 and a molecular weight of 129.21 g/mol. Its IUPAC name is 1-pyrrolidin-2-ylethane-1,2-diamine.
| Compound Name | 1-pyrrolidin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 10866359 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | 1-pyrrolidin-2-ylethane-1,2-diamine |
| SMILES | NCC(N)C1CCCN1 |
| InChI | InChI=1S/C6H15N3/c7-4-5(8)6-2-1-3-9-6/h5-6,9H,1-4,7-8H2 |
| InChIKey | MLNHHAOOGZRHIW-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |