C34H30N2O6 — CID 108667093
N-[3-[(3E)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 108667093) has the molecular formula C34H30N2O6 and a molecular weight of 562.62 g/mol. Its IUPAC name is N-[3-[(3E)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[3-[(3E)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 108667093 |
| Molecular Formula | C34H30N2O6 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | N-[3-[(3E)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | COc1cccc(C2/C(=C(\O)c3ccc(OCc4ccccc4)c(C)c3)C(=O)C(=O)N2c2cccc(NC(C)=O)c2)c1 |
| InChI | InChI=1S/C34H30N2O6/c1-21-17-25(15-16-29(21)42-20-23-9-5-4-6-10-23)32(38)30-31(24-11-7-14-28(18-24)41-3)36(34(40)33(30)39)27-13-8-12-26(19-27)35-22(2)37/h4-19,31,38H,20H2,1-3H3,(H,35,37)/b32-30+ |
| InChIKey | UTNMGXDBMQNEMK-NHQGMKOOSA-N |
| XLogP | 6.17 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|