C34H29NO7 — CID 108666746
2-[4-[(3Z)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid (PubChem CID 108666746) has the molecular formula C34H29NO7 and a molecular weight of 563.61 g/mol. Its IUPAC name is 2-[4-[(3Z)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[(3Z)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 108666746 |
| Molecular Formula | C34H29NO7 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | 2-[4-[(3Z)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetic acid |
| SMILES | COc1cccc(C2/C(=C(/O)c3ccc(OCc4ccccc4)c(C)c3)C(=O)C(=O)N2c2ccc(CC(=O)O)cc2)c1 |
| InChI | InChI=1S/C34H29NO7/c1-21-17-25(13-16-28(21)42-20-23-7-4-3-5-8-23)32(38)30-31(24-9-6-10-27(19-24)41-2)35(34(40)33(30)39)26-14-11-22(12-15-26)18-29(36)37/h3-17,19,31,38H,18,20H2,1-2H3,(H,36,37)/b32-30- |
| InChIKey | OJJSHWWXWBAZGE-GCUVURNUSA-N |
| XLogP | 5.84 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|