C36H35NO5 — CID 108676302
(4E)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-1-(4-methylphenyl)-5-[3-(2-methylpropoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 108676302) has the molecular formula C36H35NO5 and a molecular weight of 561.68 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-1-(4-methylphenyl)-5-[3-(2-methylpropoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-1-(4-methylphenyl)-5-[3-(2-methylpropoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108676302 |
| Molecular Formula | C36H35NO5 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | (4E)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-1-(4-methylphenyl)-5-[3-(2-methylpropoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(N2C(=O)C(=O)/C(=C(/O)c3ccc(OCc4ccccc4)c(C)c3)C2c2cccc(OCC(C)C)c2)cc1 |
| InChI | InChI=1S/C36H35NO5/c1-23(2)21-41-30-12-8-11-27(20-30)33-32(35(39)36(40)37(33)29-16-13-24(3)14-17-29)34(38)28-15-18-31(25(4)19-28)42-22-26-9-6-5-7-10-26/h5-20,23,33,38H,21-22H2,1-4H3/b34-32+ |
| InChIKey | PZAHYVWTLZUNKS-NWBJSICCSA-N |
| XLogP | 7.54 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|