C30H31ClN2O4 — CID 108669902
(4Z)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-[4-(diethylamino)phenyl]-5-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108669902) has the molecular formula C30H31ClN2O4 and a molecular weight of 519.04 g/mol. Its IUPAC name is (4Z)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-[4-(diethylamino)phenyl]-5-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-[4-(diethylamino)phenyl]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108669902 |
| Molecular Formula | C30H31ClN2O4 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | (4Z)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-[4-(diethylamino)phenyl]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(/C(O)=C2/C(=O)C(=O)N(c3ccc(N(CC)CC)cc3)C2c2cccc(C)c2)ccc1Cl |
| InChI | InChI=1S/C30H31ClN2O4/c1-5-32(6-2)22-12-14-23(15-13-22)33-27(20-10-8-9-19(4)17-20)26(29(35)30(33)36)28(34)21-11-16-24(31)25(18-21)37-7-3/h8-18,27,34H,5-7H2,1-4H3/b28-26- |
| InChIKey | KYVWTGFXQQNIMU-SGEDCAFJSA-N |
| XLogP | 6.52 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|