C29H29ClN2O4 — CID 108684559
(4E)-4-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-[4-(diethylamino)phenyl]-5-(2-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108684559) has the molecular formula C29H29ClN2O4 and a molecular weight of 505.01 g/mol. Its IUPAC name is (4E)-4-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-[4-(diethylamino)phenyl]-5-(2-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-[4-(diethylamino)phenyl]-5-(2-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108684559 |
| Molecular Formula | C29H29ClN2O4 |
| Molecular Weight | 505.01 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | (4E)-4-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-[4-(diethylamino)phenyl]-5-(2-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCN(CC)c1ccc(N2C(=O)C(=O)/C(=C(/O)c3ccc(Cl)c(OC)c3)C2c2ccccc2C)cc1 |
| InChI | InChI=1S/C29H29ClN2O4/c1-5-31(6-2)20-12-14-21(15-13-20)32-26(22-10-8-7-9-18(22)3)25(28(34)29(32)35)27(33)19-11-16-23(30)24(17-19)36-4/h7-17,26,33H,5-6H2,1-4H3/b27-25+ |
| InChIKey | HSXGAWPJVYWCRE-IMVLJIQESA-N |
| XLogP | 6.13 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.01 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|