C32H36N2O4 — CID 108684604
(4E)-1-[4-(diethylamino)phenyl]-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-5-(2-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108684604) has the molecular formula C32H36N2O4 and a molecular weight of 512.65 g/mol. Its IUPAC name is (4E)-1-[4-(diethylamino)phenyl]-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-5-(2-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-[4-(diethylamino)phenyl]-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-5-(2-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108684604 |
| Molecular Formula | C32H36N2O4 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | (4E)-1-[4-(diethylamino)phenyl]-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-5-(2-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCN(CC)c1ccc(N2C(=O)C(=O)/C(=C(/O)c3ccc(OCC(C)C)cc3)C2c2ccccc2C)cc1 |
| InChI | InChI=1S/C32H36N2O4/c1-6-33(7-2)24-14-16-25(17-15-24)34-29(27-11-9-8-10-22(27)5)28(31(36)32(34)37)30(35)23-12-18-26(19-13-23)38-20-21(3)4/h8-19,21,29,35H,6-7,20H2,1-5H3/b30-28+ |
| InChIKey | LSEBMPQTHJKMKX-SJCQXOIGSA-N |
| XLogP | 6.50 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|