C28H23BrN2O5 — CID 108671181
4-[(4Z)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-(4-propan-2-yloxyphenyl)pyrrolidin-1-yl]benzonitrile (PubChem CID 108671181) has the molecular formula C28H23BrN2O5 and a molecular weight of 547.41 g/mol. Its IUPAC name is 4-[(4Z)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-(4-propan-2-yloxyphenyl)pyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(4Z)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-(4-propan-2-yloxyphenyl)pyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108671181 |
| Molecular Formula | C28H23BrN2O5 |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | 4-[(4Z)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-(4-propan-2-yloxyphenyl)pyrrolidin-1-yl]benzonitrile |
| SMILES | COc1ccc(/C(O)=C2/C(=O)C(=O)N(c3ccc(C#N)cc3)C2c2ccc(OC(C)C)cc2)cc1Br |
| InChI | InChI=1S/C28H23BrN2O5/c1-16(2)36-21-11-6-18(7-12-21)25-24(26(32)19-8-13-23(35-3)22(29)14-19)27(33)28(34)31(25)20-9-4-17(15-30)5-10-20/h4-14,16,25,32H,1-3H3/b26-24- |
| InChIKey | VGWMGBWLCZXOSV-LCUIJRPUSA-N |
| XLogP | 5.74 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|