C29H28BrNO5 — CID 108665375
(4Z)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-1-(4-tert-butylphenyl)-5-(4-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108665375) has the molecular formula C29H28BrNO5 and a molecular weight of 550.45 g/mol. Its IUPAC name is (4Z)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-1-(4-tert-butylphenyl)-5-(4-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-1-(4-tert-butylphenyl)-5-(4-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108665375 |
| Molecular Formula | C29H28BrNO5 |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | (4Z)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-1-(4-tert-butylphenyl)-5-(4-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2/C(=C(/O)c3ccc(OC)c(Br)c3)C(=O)C(=O)N2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H28BrNO5/c1-29(2,3)19-9-11-20(12-10-19)31-25(17-6-13-21(35-4)14-7-17)24(27(33)28(31)34)26(32)18-8-15-23(36-5)22(30)16-18/h6-16,25,32H,1-5H3/b26-24- |
| InChIKey | FKQMHDJRVKUZHK-LCUIJRPUSA-N |
| XLogP | 6.39 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|