C29H27NO6 — CID 108665354
(4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(4-tert-butylphenyl)-5-(4-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108665354) has the molecular formula C29H27NO6 and a molecular weight of 485.54 g/mol. Its IUPAC name is (4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(4-tert-butylphenyl)-5-(4-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(4-tert-butylphenyl)-5-(4-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108665354 |
| Molecular Formula | C29H27NO6 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | (4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(4-tert-butylphenyl)-5-(4-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2/C(=C(/O)c3ccc4c(c3)OCO4)C(=O)C(=O)N2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H27NO6/c1-29(2,3)19-8-10-20(11-9-19)30-25(17-5-12-21(34-4)13-6-17)24(27(32)28(30)33)26(31)18-7-14-22-23(15-18)36-16-35-22/h5-15,25,31H,16H2,1-4H3/b26-24- |
| InChIKey | CWQSWOAYXKASSG-LCUIJRPUSA-N |
| XLogP | 5.35 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|