C28H23ClFNO5 — CID 108717781
(4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(4-tert-butylphenyl)-1-(3-chloro-4-fluorophenyl)pyrrolidine-2,3-dione (PubChem CID 108717781) has the molecular formula C28H23ClFNO5 and a molecular weight of 507.95 g/mol. Its IUPAC name is (4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(4-tert-butylphenyl)-1-(3-chloro-4-fluorophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(4-tert-butylphenyl)-1-(3-chloro-4-fluorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108717781 |
| Molecular Formula | C28H23ClFNO5 |
| Molecular Weight | 507.95 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | (4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(4-tert-butylphenyl)-1-(3-chloro-4-fluorophenyl)pyrrolidine-2,3-dione |
| SMILES | CC(C)(C)c1ccc(C2/C(=C(/O)c3ccc4c(c3)OCO4)C(=O)C(=O)N2c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C28H23ClFNO5/c1-28(2,3)17-7-4-15(5-8-17)24-23(25(32)16-6-11-21-22(12-16)36-14-35-21)26(33)27(34)31(24)18-9-10-20(30)19(29)13-18/h4-13,24,32H,14H2,1-3H3/b25-23- |
| InChIKey | VMBTUMWNQPFUGH-BZZOAKBMSA-N |
| XLogP | 6.13 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.95 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|