C26H19ClFNO7 — CID 108715867
(4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(3-chloro-4-fluorophenyl)-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108715867) has the molecular formula C26H19ClFNO7 and a molecular weight of 511.89 g/mol. Its IUPAC name is (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(3-chloro-4-fluorophenyl)-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(3-chloro-4-fluorophenyl)-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108715867 |
| Molecular Formula | C26H19ClFNO7 |
| Molecular Weight | 511.89 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(3-chloro-4-fluorophenyl)-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2/C(=C(\O)c3ccc4c(c3)OCO4)C(=O)C(=O)N2c2ccc(F)c(Cl)c2)ccc1O |
| InChI | InChI=1S/C26H19ClFNO7/c1-2-34-20-9-13(3-7-18(20)30)23-22(24(31)14-4-8-19-21(10-14)36-12-35-19)25(32)26(33)29(23)15-5-6-17(28)16(27)11-15/h3-11,23,30-31H,2,12H2,1H3/b24-22+ |
| InChIKey | VMCXUWSSTOXVQT-ZNTNEXAZSA-N |
| XLogP | 4.94 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.89 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|