C28H24ClNO8 — CID 108715739
(4E)-1-(1,3-benzodioxol-5-yl)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108715739) has the molecular formula C28H24ClNO8 and a molecular weight of 537.95 g/mol. Its IUPAC name is (4E)-1-(1,3-benzodioxol-5-yl)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(1,3-benzodioxol-5-yl)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108715739 |
| Molecular Formula | C28H24ClNO8 |
| Molecular Weight | 537.95 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | (4E)-1-(1,3-benzodioxol-5-yl)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2/C(=C(\O)c3ccc(Cl)c(OCC)c3)C(=O)C(=O)N2c2ccc3c(c2)OCO3)ccc1O |
| InChI | InChI=1S/C28H24ClNO8/c1-3-35-21-12-16(5-8-18(21)29)26(32)24-25(15-6-9-19(31)22(11-15)36-4-2)30(28(34)27(24)33)17-7-10-20-23(13-17)38-14-37-20/h5-13,25,31-32H,3-4,14H2,1-2H3/b26-24+ |
| InChIKey | QCQQDUMXJXREPO-SHHOIMCASA-N |
| XLogP | 5.20 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.95 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|