C26H20N2O9 — CID 108715759
(4E)-1-(1,3-benzodioxol-5-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(3-nitrophenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108715759) has the molecular formula C26H20N2O9 and a molecular weight of 504.45 g/mol. Its IUPAC name is (4E)-1-(1,3-benzodioxol-5-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(3-nitrophenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(1,3-benzodioxol-5-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(3-nitrophenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108715759 |
| Molecular Formula | C26H20N2O9 |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | (4E)-1-(1,3-benzodioxol-5-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(3-nitrophenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2/C(=C(\O)c3cccc([N+](=O)[O-])c3)C(=O)C(=O)N2c2ccc3c(c2)OCO3)ccc1O |
| InChI | InChI=1S/C26H20N2O9/c1-2-35-20-11-14(6-8-18(20)29)23-22(24(30)15-4-3-5-17(10-15)28(33)34)25(31)26(32)27(23)16-7-9-19-21(12-16)37-13-36-19/h3-12,23,29-30H,2,13H2,1H3/b24-22+ |
| InChIKey | LQABWUDBUJXXDJ-ZNTNEXAZSA-N |
| XLogP | 4.05 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|